C12H8F5NO — CID 115051204
1-(3,3-difluoro-1-isocyanatocyclobutyl)-3-(trifluoromethyl)benzene (PubChem CID 115051204) has the molecular formula C12H8F5NO and a molecular weight of 277.19 g/mol. Its IUPAC name is 1-(3,3-difluoro-1-isocyanatocyclobutyl)-3-(trifluoromethyl)benzene.
| Compound Name | 1-(3,3-difluoro-1-isocyanatocyclobutyl)-3-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 115051204 |
| Molecular Formula | C12H8F5NO |
| Molecular Weight | 277.19 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | 1-(3,3-difluoro-1-isocyanatocyclobutyl)-3-(trifluoromethyl)benzene |
| SMILES | O=C=NC1(c2cccc(C(F)(F)F)c2)CC(F)(F)C1 |
| InChI | InChI=1S/C12H8F5NO/c13-11(14)5-10(6-11,18-7-19)8-2-1-3-9(4-8)12(15,16)17/h1-4H,5-6H2 |
| InChIKey | HPXPVBIWIWXFPG-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.19 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|