C16H18N2 — CID 11746693
14-methyl-10,14-diazatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17),15-pentaene (PubChem CID 11746693) has the molecular formula C16H18N2 and a molecular weight of 238.33 g/mol. Its IUPAC name is 14-methyl-10,14-diazatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17),15-pentaene.
| Compound Name | 14-methyl-10,14-diazatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17),15-pentaene |
|---|---|
| PubChem CID | 11746693 |
| Molecular Formula | C16H18N2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 14-methyl-10,14-diazatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17),15-pentaene |
| SMILES | Cn1ccc2c1CCN1CCc3ccccc3C21 |
| InChI | InChI=1S/C16H18N2/c1-17-9-7-14-15(17)8-11-18-10-6-12-4-2-3-5-13(12)16(14)18/h2-5,7,9,16H,6,8,10-11H2,1H3 |
| InChIKey | YMBSJPOFTIRLJS-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |