C19H31NO — CID 117467895
2-piperidin-2-yl-4-(2,4,4-trimethylpentan-2-yl)phenol (PubChem CID 117467895) has the molecular formula C19H31NO and a molecular weight of 289.46 g/mol. Its IUPAC name is 2-piperidin-2-yl-4-(2,4,4-trimethylpentan-2-yl)phenol.
| Compound Name | 2-piperidin-2-yl-4-(2,4,4-trimethylpentan-2-yl)phenol |
|---|---|
| PubChem CID | 117467895 |
| Molecular Formula | C19H31NO |
| Molecular Weight | 289.46 g/mol |
| Exact Mass | 289.24 |
| IUPAC Name | 2-piperidin-2-yl-4-(2,4,4-trimethylpentan-2-yl)phenol |
| SMILES | CC(C)(C)CC(C)(C)c1ccc(O)c(C2CCCCN2)c1 |
| InChI | InChI=1S/C19H31NO/c1-18(2,3)13-19(4,5)14-9-10-17(21)15(12-14)16-8-6-7-11-20-16/h9-10,12,16,20-21H,6-8,11,13H2,1-5H3 |
| InChIKey | LZMLJJRCCLRUNQ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.46 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|