C14H17N3O4 — CID 117470471
methyl 3-(5-amino-1-methylpyrazol-3-yl)-4,5-dimethoxybenzoate (PubChem CID 117470471) has the molecular formula C14H17N3O4 and a molecular weight of 291.31 g/mol. Its IUPAC name is methyl 3-(5-amino-1-methylpyrazol-3-yl)-4,5-dimethoxybenzoate.
| Compound Name | methyl 3-(5-amino-1-methylpyrazol-3-yl)-4,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 117470471 |
| Molecular Formula | C14H17N3O4 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | methyl 3-(5-amino-1-methylpyrazol-3-yl)-4,5-dimethoxybenzoate |
| SMILES | COC(=O)c1cc(OC)c(OC)c(-c2cc(N)n(C)n2)c1 |
| InChI | InChI=1S/C14H17N3O4/c1-17-12(15)7-10(16-17)9-5-8(14(18)21-4)6-11(19-2)13(9)20-3/h5-7H,15H2,1-4H3 |
| InChIKey | LFZBMOSKKIYXNM-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |