C18H26FNO — CID 117470930
[1-[2-(cyclobutylmethoxy)-5-fluorophenyl]cyclohexyl]methanamine (PubChem CID 117470930) has the molecular formula C18H26FNO and a molecular weight of 291.41 g/mol. Its IUPAC name is [1-[2-(cyclobutylmethoxy)-5-fluorophenyl]cyclohexyl]methanamine.
| Compound Name | [1-[2-(cyclobutylmethoxy)-5-fluorophenyl]cyclohexyl]methanamine |
|---|---|
| PubChem CID | 117470930 |
| Molecular Formula | C18H26FNO |
| Molecular Weight | 291.41 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | [1-[2-(cyclobutylmethoxy)-5-fluorophenyl]cyclohexyl]methanamine |
| SMILES | NCC1(c2cc(F)ccc2OCC2CCC2)CCCCC1 |
| InChI | InChI=1S/C18H26FNO/c19-15-7-8-17(21-12-14-5-4-6-14)16(11-15)18(13-20)9-2-1-3-10-18/h7-8,11,14H,1-6,9-10,12-13,20H2 |
| InChIKey | HFONRWAZHMFQPT-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.41 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |