C17H23ClO2 — CID 117475530
3-(3-chloro-4-cyclohexylphenyl)-3-methylbutanoic acid (PubChem CID 117475530) has the molecular formula C17H23ClO2 and a molecular weight of 294.82 g/mol. Its IUPAC name is 3-(3-chloro-4-cyclohexylphenyl)-3-methylbutanoic acid.
| Compound Name | 3-(3-chloro-4-cyclohexylphenyl)-3-methylbutanoic acid |
|---|---|
| PubChem CID | 117475530 |
| Molecular Formula | C17H23ClO2 |
| Molecular Weight | 294.82 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 3-(3-chloro-4-cyclohexylphenyl)-3-methylbutanoic acid |
| SMILES | CC(C)(CC(=O)O)c1ccc(C2CCCCC2)c(Cl)c1 |
| InChI | InChI=1S/C17H23ClO2/c1-17(2,11-16(19)20)13-8-9-14(15(18)10-13)12-6-4-3-5-7-12/h8-10,12H,3-7,11H2,1-2H3,(H,19,20) |
| InChIKey | WGOXFRLWGWQRID-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.82 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |