C15H19ClO4 — CID 117481244
3-[3-chloro-4-(oxolan-3-yloxy)phenyl]-3-methylbutanoic acid (PubChem CID 117481244) has the molecular formula C15H19ClO4 and a molecular weight of 298.77 g/mol. Its IUPAC name is 3-[3-chloro-4-(oxolan-3-yloxy)phenyl]-3-methylbutanoic acid.
| Compound Name | 3-[3-chloro-4-(oxolan-3-yloxy)phenyl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 117481244 |
| Molecular Formula | C15H19ClO4 |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 3-[3-chloro-4-(oxolan-3-yloxy)phenyl]-3-methylbutanoic acid |
| SMILES | CC(C)(CC(=O)O)c1ccc(OC2CCOC2)c(Cl)c1 |
| InChI | InChI=1S/C15H19ClO4/c1-15(2,8-14(17)18)10-3-4-13(12(16)7-10)20-11-5-6-19-9-11/h3-4,7,11H,5-6,8-9H2,1-2H3,(H,17,18) |
| InChIKey | WVPNICHNVFQVJH-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |