C15H20ClNO3 — CID 117479380
ethyl 2-[3-chloro-4-(1-methylpyrrolidin-3-yl)phenyl]-2-hydroxyacetate (PubChem CID 117479380) has the molecular formula C15H20ClNO3 and a molecular weight of 297.78 g/mol. Its IUPAC name is ethyl 2-[3-chloro-4-(1-methylpyrrolidin-3-yl)phenyl]-2-hydroxyacetate.
| Compound Name | ethyl 2-[3-chloro-4-(1-methylpyrrolidin-3-yl)phenyl]-2-hydroxyacetate |
|---|---|
| PubChem CID | 117479380 |
| Molecular Formula | C15H20ClNO3 |
| Molecular Weight | 297.78 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | ethyl 2-[3-chloro-4-(1-methylpyrrolidin-3-yl)phenyl]-2-hydroxyacetate |
| SMILES | CCOC(=O)C(O)c1ccc(C2CCN(C)C2)c(Cl)c1 |
| InChI | InChI=1S/C15H20ClNO3/c1-3-20-15(19)14(18)10-4-5-12(13(16)8-10)11-6-7-17(2)9-11/h4-5,8,11,14,18H,3,6-7,9H2,1-2H3 |
| InChIKey | ZSGFTAJMFCFADC-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.78 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |