C15H19FO3S — CID 117480935
1-(5-fluoro-2-methoxy-3-methylsulfanylphenyl)cyclohexane-1-carboxylic acid (PubChem CID 117480935) has the molecular formula C15H19FO3S and a molecular weight of 298.38 g/mol. Its IUPAC name is 1-(5-fluoro-2-methoxy-3-methylsulfanylphenyl)cyclohexane-1-carboxylic acid.
| Compound Name | 1-(5-fluoro-2-methoxy-3-methylsulfanylphenyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 117480935 |
| Molecular Formula | C15H19FO3S |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 1-(5-fluoro-2-methoxy-3-methylsulfanylphenyl)cyclohexane-1-carboxylic acid |
| SMILES | COc1c(SC)cc(F)cc1C1(C(=O)O)CCCCC1 |
| InChI | InChI=1S/C15H19FO3S/c1-19-13-11(8-10(16)9-12(13)20-2)15(14(17)18)6-4-3-5-7-15/h8-9H,3-7H2,1-2H3,(H,17,18) |
| InChIKey | DKIZFWMZDNSSKI-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |