C15H17F3O3 — CID 117486934
1-[3-(difluoromethyl)-5-fluoro-2-methoxyphenyl]cyclohexane-1-carboxylic acid (PubChem CID 117486934) has the molecular formula C15H17F3O3 and a molecular weight of 302.29 g/mol. Its IUPAC name is 1-[3-(difluoromethyl)-5-fluoro-2-methoxyphenyl]cyclohexane-1-carboxylic acid.
| Compound Name | 1-[3-(difluoromethyl)-5-fluoro-2-methoxyphenyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 117486934 |
| Molecular Formula | C15H17F3O3 |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 1-[3-(difluoromethyl)-5-fluoro-2-methoxyphenyl]cyclohexane-1-carboxylic acid |
| SMILES | COc1c(C(F)F)cc(F)cc1C1(C(=O)O)CCCCC1 |
| InChI | InChI=1S/C15H17F3O3/c1-21-12-10(13(17)18)7-9(16)8-11(12)15(14(19)20)5-3-2-4-6-15/h7-8,13H,2-6H2,1H3,(H,19,20) |
| InChIKey | ROOOSFSFJANUHW-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |