C16H17NO4 — CID 11748175
(3-aminophenyl)-(3,4,5-trimethoxyphenyl)methanone (PubChem CID 11748175) has the molecular formula C16H17NO4 and a molecular weight of 287.31 g/mol. Its IUPAC name is (3-aminophenyl)-(3,4,5-trimethoxyphenyl)methanone.
| Compound Name | (3-aminophenyl)-(3,4,5-trimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 11748175 |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | (3-aminophenyl)-(3,4,5-trimethoxyphenyl)methanone |
| SMILES | COc1cc(C(=O)c2cccc(N)c2)cc(OC)c1OC |
| InChI | InChI=1S/C16H17NO4/c1-19-13-8-11(9-14(20-2)16(13)21-3)15(18)10-5-4-6-12(17)7-10/h4-9H,17H2,1-3H3 |
| InChIKey | KNUNJKODSUTCGZ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|