C17H24N4O — CID 117484248
1,4-dimethyl-3-[3-(2-piperazin-1-ylethyl)phenyl]imidazol-2-one (PubChem CID 117484248) has the molecular formula C17H24N4O and a molecular weight of 300.41 g/mol. Its IUPAC name is 1,4-dimethyl-3-[3-(2-piperazin-1-ylethyl)phenyl]imidazol-2-one.
| Compound Name | 1,4-dimethyl-3-[3-(2-piperazin-1-ylethyl)phenyl]imidazol-2-one |
|---|---|
| PubChem CID | 117484248 |
| Molecular Formula | C17H24N4O |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | 1,4-dimethyl-3-[3-(2-piperazin-1-ylethyl)phenyl]imidazol-2-one |
| SMILES | Cc1cn(C)c(=O)n1-c1cccc(CCN2CCNCC2)c1 |
| InChI | InChI=1S/C17H24N4O/c1-14-13-19(2)17(22)21(14)16-5-3-4-15(12-16)6-9-20-10-7-18-8-11-20/h3-5,12-13,18H,6-11H2,1-2H3 |
| InChIKey | QZLOQAUFQOBMFS-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 42.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |