C13H20N6 — CID 118047878
1-[2-[3-(2,3-dihydrotetrazol-1-yl)phenyl]ethyl]piperazine (PubChem CID 118047878) has the molecular formula C13H20N6 and a molecular weight of 260.34 g/mol. Its IUPAC name is 1-[2-[3-(2,3-dihydrotetrazol-1-yl)phenyl]ethyl]piperazine.
| Compound Name | 1-[2-[3-(2,3-dihydrotetrazol-1-yl)phenyl]ethyl]piperazine |
|---|---|
| PubChem CID | 118047878 |
| Molecular Formula | C13H20N6 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.17 |
| IUPAC Name | 1-[2-[3-(2,3-dihydrotetrazol-1-yl)phenyl]ethyl]piperazine |
| SMILES | C1=NNNN1c1cccc(CCN2CCNCC2)c1 |
| InChI | InChI=1S/C13H20N6/c1-2-12(4-7-18-8-5-14-6-9-18)10-13(3-1)19-11-15-16-17-19/h1-3,10-11,14,16-17H,4-9H2 |
| InChIKey | NZZNBTATDMRYOF-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 54.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |