C16H22N4O2 — CID 117487248
1-[2-(2-piperazin-1-ylethyl)phenyl]piperazine-2,5-dione (PubChem CID 117487248) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is 1-[2-(2-piperazin-1-ylethyl)phenyl]piperazine-2,5-dione.
| Compound Name | 1-[2-(2-piperazin-1-ylethyl)phenyl]piperazine-2,5-dione |
|---|---|
| PubChem CID | 117487248 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 1-[2-(2-piperazin-1-ylethyl)phenyl]piperazine-2,5-dione |
| SMILES | O=C1CN(c2ccccc2CCN2CCNCC2)C(=O)CN1 |
| InChI | InChI=1S/C16H22N4O2/c21-15-12-20(16(22)11-18-15)14-4-2-1-3-13(14)5-8-19-9-6-17-7-10-19/h1-4,17H,5-12H2,(H,18,21) |
| InChIKey | ZPBKUYMKOCOWJB-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |