C10H8BrF2N3O — CID 117488856
5-(3-bromo-2,5-difluoro-6-methoxyphenyl)-1H-pyrazol-3-amine (PubChem CID 117488856) has the molecular formula C10H8BrF2N3O and a molecular weight of 304.09 g/mol. Its IUPAC name is 5-(3-bromo-2,5-difluoro-6-methoxyphenyl)-1H-pyrazol-3-amine.
| Compound Name | 5-(3-bromo-2,5-difluoro-6-methoxyphenyl)-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 117488856 |
| Molecular Formula | C10H8BrF2N3O |
| Molecular Weight | 304.09 g/mol |
| Exact Mass | 302.98 |
| IUPAC Name | 5-(3-bromo-2,5-difluoro-6-methoxyphenyl)-1H-pyrazol-3-amine |
| SMILES | COc1c(F)cc(Br)c(F)c1-c1cc(N)n[nH]1 |
| InChI | InChI=1S/C10H8BrF2N3O/c1-17-10-5(12)2-4(11)9(13)8(10)6-3-7(14)16-15-6/h2-3H,1H3,(H3,14,15,16) |
| InChIKey | QSISSHZARPWIIN-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.09 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|