C18H25NO5S — CID 11748930
2-(benzenesulfonyl)-1-[(2S)-2-(oxan-2-yloxymethyl)pyrrolidin-1-yl]ethanone (PubChem CID 11748930) has the molecular formula C18H25NO5S and a molecular weight of 367.47 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-1-[(2S)-2-(oxan-2-yloxymethyl)pyrrolidin-1-yl]ethanone.
| Compound Name | 2-(benzenesulfonyl)-1-[(2S)-2-(oxan-2-yloxymethyl)pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 11748930 |
| Molecular Formula | C18H25NO5S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 2-(benzenesulfonyl)-1-[(2S)-2-(oxan-2-yloxymethyl)pyrrolidin-1-yl]ethanone |
| SMILES | O=C(CS(=O)(=O)c1ccccc1)N1CCC[C@H]1COC1CCCCO1 |
| InChI | InChI=1S/C18H25NO5S/c20-17(14-25(21,22)16-8-2-1-3-9-16)19-11-6-7-15(19)13-24-18-10-4-5-12-23-18/h1-3,8-9,15,18H,4-7,10-14H2/t15-,18?/m0/s1 |
| InChIKey | DFXJXXZHHJRJNU-BUSXIPJBSA-N |
| XLogP | 1.99 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |