C18H28FN3 — CID 117490871
[5-[3-fluoro-4-(piperidin-1-ylmethyl)phenyl]-1-methylpyrrolidin-3-yl]methanamine (PubChem CID 117490871) has the molecular formula C18H28FN3 and a molecular weight of 305.44 g/mol. Its IUPAC name is [5-[3-fluoro-4-(piperidin-1-ylmethyl)phenyl]-1-methylpyrrolidin-3-yl]methanamine.
| Compound Name | [5-[3-fluoro-4-(piperidin-1-ylmethyl)phenyl]-1-methylpyrrolidin-3-yl]methanamine |
|---|---|
| PubChem CID | 117490871 |
| Molecular Formula | C18H28FN3 |
| Molecular Weight | 305.44 g/mol |
| Exact Mass | 305.23 |
| IUPAC Name | [5-[3-fluoro-4-(piperidin-1-ylmethyl)phenyl]-1-methylpyrrolidin-3-yl]methanamine |
| SMILES | CN1CC(CN)CC1c1ccc(CN2CCCCC2)c(F)c1 |
| InChI | InChI=1S/C18H28FN3/c1-21-12-14(11-20)9-18(21)15-5-6-16(17(19)10-15)13-22-7-3-2-4-8-22/h5-6,10,14,18H,2-4,7-9,11-13,20H2,1H3 |
| InChIKey | JMAJIZMSKUUKMQ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.44 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |