C17H26FN3O — CID 117492434
[5-[3-fluoro-4-(morpholin-4-ylmethyl)phenyl]-1-methylpyrrolidin-3-yl]methanamine (PubChem CID 117492434) has the molecular formula C17H26FN3O and a molecular weight of 307.41 g/mol. Its IUPAC name is [5-[3-fluoro-4-(morpholin-4-ylmethyl)phenyl]-1-methylpyrrolidin-3-yl]methanamine.
| Compound Name | [5-[3-fluoro-4-(morpholin-4-ylmethyl)phenyl]-1-methylpyrrolidin-3-yl]methanamine |
|---|---|
| PubChem CID | 117492434 |
| Molecular Formula | C17H26FN3O |
| Molecular Weight | 307.41 g/mol |
| Exact Mass | 307.21 |
| IUPAC Name | [5-[3-fluoro-4-(morpholin-4-ylmethyl)phenyl]-1-methylpyrrolidin-3-yl]methanamine |
| SMILES | CN1CC(CN)CC1c1ccc(CN2CCOCC2)c(F)c1 |
| InChI | InChI=1S/C17H26FN3O/c1-20-11-13(10-19)8-17(20)14-2-3-15(16(18)9-14)12-21-4-6-22-7-5-21/h2-3,9,13,17H,4-8,10-12,19H2,1H3 |
| InChIKey | WKKPPEJOQINXJD-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.41 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |