C16H23FN2O — CID 117446553
4-[(2-fluoro-4-piperidin-3-ylphenyl)methyl]morpholine (PubChem CID 117446553) has the molecular formula C16H23FN2O and a molecular weight of 278.37 g/mol. Its IUPAC name is 4-[(2-fluoro-4-piperidin-3-ylphenyl)methyl]morpholine.
| Compound Name | 4-[(2-fluoro-4-piperidin-3-ylphenyl)methyl]morpholine |
|---|---|
| PubChem CID | 117446553 |
| Molecular Formula | C16H23FN2O |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | 4-[(2-fluoro-4-piperidin-3-ylphenyl)methyl]morpholine |
| SMILES | Fc1cc(C2CCCNC2)ccc1CN1CCOCC1 |
| InChI | InChI=1S/C16H23FN2O/c17-16-10-13(14-2-1-5-18-11-14)3-4-15(16)12-19-6-8-20-9-7-19/h3-4,10,14,18H,1-2,5-9,11-12H2 |
| InChIKey | RXJZIPMESJYHSI-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |