C13H10F4O4 — CID 117491421
2-[1-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)cyclopropyl]acetic acid (PubChem CID 117491421) has the molecular formula C13H10F4O4 and a molecular weight of 306.21 g/mol. Its IUPAC name is 2-[1-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)cyclopropyl]acetic acid.
| Compound Name | 2-[1-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)cyclopropyl]acetic acid |
|---|---|
| PubChem CID | 117491421 |
| Molecular Formula | C13H10F4O4 |
| Molecular Weight | 306.21 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | 2-[1-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)cyclopropyl]acetic acid |
| SMILES | O=C(O)CC1(c2ccc3c(c2)OC(F)(F)C(F)(F)O3)CC1 |
| InChI | InChI=1S/C13H10F4O4/c14-12(15)13(16,17)21-9-5-7(1-2-8(9)20-12)11(3-4-11)6-10(18)19/h1-2,5H,3-4,6H2,(H,18,19) |
| InChIKey | CIGKGRSRGWRCLD-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.21 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|