C22H22N4O2 — CID 11749162
3-[4-(3-phenyl-1H-pyrrole-2-carbonyl)piperazin-1-yl]benzamide (PubChem CID 11749162) has the molecular formula C22H22N4O2 and a molecular weight of 374.44 g/mol. Its IUPAC name is 3-[4-(3-phenyl-1H-pyrrole-2-carbonyl)piperazin-1-yl]benzamide.
| Compound Name | 3-[4-(3-phenyl-1H-pyrrole-2-carbonyl)piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 11749162 |
| Molecular Formula | C22H22N4O2 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 3-[4-(3-phenyl-1H-pyrrole-2-carbonyl)piperazin-1-yl]benzamide |
| SMILES | NC(=O)c1cccc(N2CCN(C(=O)c3[nH]ccc3-c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C22H22N4O2/c23-21(27)17-7-4-8-18(15-17)25-11-13-26(14-12-25)22(28)20-19(9-10-24-20)16-5-2-1-3-6-16/h1-10,15,24H,11-14H2,(H2,23,27) |
| InChIKey | OSMVJIRBVRPVLQ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |