C9H6BrClFN3O — CID 117491798
[3-(5-bromo-2-chloro-3-fluorophenyl)-1,2,4-oxadiazol-5-yl]methanamine (PubChem CID 117491798) has the molecular formula C9H6BrClFN3O and a molecular weight of 306.52 g/mol. Its IUPAC name is [3-(5-bromo-2-chloro-3-fluorophenyl)-1,2,4-oxadiazol-5-yl]methanamine.
| Compound Name | [3-(5-bromo-2-chloro-3-fluorophenyl)-1,2,4-oxadiazol-5-yl]methanamine |
|---|---|
| PubChem CID | 117491798 |
| Molecular Formula | C9H6BrClFN3O |
| Molecular Weight | 306.52 g/mol |
| Exact Mass | 304.94 |
| IUPAC Name | [3-(5-bromo-2-chloro-3-fluorophenyl)-1,2,4-oxadiazol-5-yl]methanamine |
| SMILES | NCc1nc(-c2cc(Br)cc(F)c2Cl)no1 |
| InChI | InChI=1S/C9H6BrClFN3O/c10-4-1-5(8(11)6(12)2-4)9-14-7(3-13)16-15-9/h1-2H,3,13H2 |
| InChIKey | JEIBJLFZISYQPS-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.52 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|