C9H8BrN3O3 — CID 136968250
3-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]-5-bromobenzene-1,2-diol (PubChem CID 136968250) has the molecular formula C9H8BrN3O3 and a molecular weight of 286.09 g/mol. Its IUPAC name is 3-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]-5-bromobenzene-1,2-diol.
| Compound Name | 3-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]-5-bromobenzene-1,2-diol |
|---|---|
| PubChem CID | 136968250 |
| Molecular Formula | C9H8BrN3O3 |
| Molecular Weight | 286.09 g/mol |
| Exact Mass | 284.97 |
| IUPAC Name | 3-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]-5-bromobenzene-1,2-diol |
| SMILES | NCc1nc(-c2cc(Br)cc(O)c2O)no1 |
| InChI | InChI=1S/C9H8BrN3O3/c10-4-1-5(8(15)6(14)2-4)9-12-7(3-11)16-13-9/h1-2,14-15H,3,11H2 |
| InChIKey | CPOPLHRAXYESDR-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.09 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|