C9H7BrFN3O3 — CID 136966499
3-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]-5-bromo-4-fluorobenzene-1,2-diol (PubChem CID 136966499) has the molecular formula C9H7BrFN3O3 and a molecular weight of 304.08 g/mol. Its IUPAC name is 3-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]-5-bromo-4-fluorobenzene-1,2-diol.
| Compound Name | 3-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]-5-bromo-4-fluorobenzene-1,2-diol |
|---|---|
| PubChem CID | 136966499 |
| Molecular Formula | C9H7BrFN3O3 |
| Molecular Weight | 304.08 g/mol |
| Exact Mass | 302.97 |
| IUPAC Name | 3-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]-5-bromo-4-fluorobenzene-1,2-diol |
| SMILES | NCc1nc(-c2c(O)c(O)cc(Br)c2F)no1 |
| InChI | InChI=1S/C9H7BrFN3O3/c10-3-1-4(15)8(16)6(7(3)11)9-13-5(2-12)17-14-9/h1,15-16H,2,12H2 |
| InChIKey | PDLXRMZOSHYAEG-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.08 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|