About 2-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]-3-bromo-5-(trifluoromethyl)phenol
2-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]-3-bromo-5-(trifluoromethyl)phenol (PubChem CID 136998209) has the molecular formula C10H7BrF3N3O2
and a molecular weight of 338.08 g/mol. Its IUPAC name is 2-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]-3-bromo-5-(trifluoromethyl)phenol.
Molecular Properties
| Compound Name | 2-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]-3-bromo-5-(trifluoromethyl)phenol |
| PubChem CID | 136998209 |
| Molecular Formula | C10H7BrF3N3O2 |
| Molecular Weight | 338.08 g/mol |
| Exact Mass | 336.97 |
| IUPAC Name | 2-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]-3-bromo-5-(trifluoromethyl)phenol |
| SMILES | NCc1nc(-c2c(O)cc(C(F)(F)F)cc2Br)no1 |
| InChI | InChI=1S/C10H7BrF3N3O2/c11-5-1-4(10(12,13)14)2-6(18)8(5)9-16-7(3-15)19-17-9/h1-2,18H,3,15H2 |
| InChIKey | AKLYCNUQGWBZJI-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.08 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]-3-bromo-5-(trifluoromethyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]-3-bromo-5-(trifluoromethyl)phenol?
The IUPAC name of 2-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]-3-bromo-5-(trifluoromethyl)phenol (CID 136998209) is 2-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]-3-bromo-5-(trifluoromethyl)phenol.
What is the SMILES notation for 2-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]-3-bromo-5-(trifluoromethyl)phenol?
The canonical SMILES for 2-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]-3-bromo-5-(trifluoromethyl)phenol is NCc1nc(-c2c(O)cc(C(F)(F)F)cc2Br)no1.
What is the InChIKey of 2-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]-3-bromo-5-(trifluoromethyl)phenol?
The InChIKey is AKLYCNUQGWBZJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7BrF3N3O2/c11-5-1-4(10(12,13)14)2-6(18)8(5)9-16-7(3-15)19-17-9/h1-2,18H,3,15H2.
What are the key properties of 2-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]-3-bromo-5-(trifluoromethyl)phenol?
2-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]-3-bromo-5-(trifluoromethyl)phenol has a molecular weight of 338.08 g/mol, XLogP of 2.68, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]-3-bromo-5-(trifluoromethyl)phenol is sourced from PubChem (CID 136998209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).