C9H4F5N3O — CID 83403632
[3-(2,3,4,5,6-pentafluorophenyl)-1,2,4-oxadiazol-5-yl]methanamine (PubChem CID 83403632) has the molecular formula C9H4F5N3O and a molecular weight of 265.14 g/mol. Its IUPAC name is [3-(2,3,4,5,6-pentafluorophenyl)-1,2,4-oxadiazol-5-yl]methanamine.
| Compound Name | [3-(2,3,4,5,6-pentafluorophenyl)-1,2,4-oxadiazol-5-yl]methanamine |
|---|---|
| PubChem CID | 83403632 |
| Molecular Formula | C9H4F5N3O |
| Molecular Weight | 265.14 g/mol |
| Exact Mass | 265.03 |
| IUPAC Name | [3-(2,3,4,5,6-pentafluorophenyl)-1,2,4-oxadiazol-5-yl]methanamine |
| SMILES | NCc1nc(-c2c(F)c(F)c(F)c(F)c2F)no1 |
| InChI | InChI=1S/C9H4F5N3O/c10-4-3(9-16-2(1-15)18-17-9)5(11)7(13)8(14)6(4)12/h1,15H2 |
| InChIKey | MFTWJWXIAMMSAD-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.14 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|