C9H6BrFN2O3 — CID 136968361
3-(3-amino-1,2-oxazol-5-yl)-5-bromo-4-fluorobenzene-1,2-diol (PubChem CID 136968361) has the molecular formula C9H6BrFN2O3 and a molecular weight of 289.06 g/mol. Its IUPAC name is 3-(3-amino-1,2-oxazol-5-yl)-5-bromo-4-fluorobenzene-1,2-diol.
| Compound Name | 3-(3-amino-1,2-oxazol-5-yl)-5-bromo-4-fluorobenzene-1,2-diol |
|---|---|
| PubChem CID | 136968361 |
| Molecular Formula | C9H6BrFN2O3 |
| Molecular Weight | 289.06 g/mol |
| Exact Mass | 287.95 |
| IUPAC Name | 3-(3-amino-1,2-oxazol-5-yl)-5-bromo-4-fluorobenzene-1,2-diol |
| SMILES | Nc1cc(-c2c(O)c(O)cc(Br)c2F)on1 |
| InChI | InChI=1S/C9H6BrFN2O3/c10-3-1-4(14)9(15)7(8(3)11)5-2-6(12)13-16-5/h1-2,14-15H,(H2,12,13) |
| InChIKey | DRLPCFZJBYZLCH-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.06 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|