C23H27FN2O2 — CID 11749382
(E)-N-[(1S)-1-[3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]phenyl]ethyl]-3-(2-fluorophenyl)prop-2-enamide (PubChem CID 11749382) has the molecular formula C23H27FN2O2 and a molecular weight of 382.48 g/mol. Its IUPAC name is (E)-N-[(1S)-1-[3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]phenyl]ethyl]-3-(2-fluorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[(1S)-1-[3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]phenyl]ethyl]-3-(2-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 11749382 |
| Molecular Formula | C23H27FN2O2 |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | (E)-N-[(1S)-1-[3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]phenyl]ethyl]-3-(2-fluorophenyl)prop-2-enamide |
| SMILES | C[C@@H]1CN(c2cccc([C@H](C)NC(=O)/C=C/c3ccccc3F)c2)C[C@H](C)O1 |
| InChI | InChI=1S/C23H27FN2O2/c1-16-14-26(15-17(2)28-16)21-9-6-8-20(13-21)18(3)25-23(27)12-11-19-7-4-5-10-22(19)24/h4-13,16-18H,14-15H2,1-3H3,(H,25,27)/b12-11+/t16-,17+,18-/m0/s1 |
| InChIKey | MMTYMNYZNWKRIA-ANPJYKQMSA-N |
| XLogP | 4.33 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|