C22H25F2N3O2 — CID 91521603
N-[(1R)-1-[3-[2-(aminomethyl)morpholin-4-yl]phenyl]ethyl]-3-(3,5-difluorophenyl)prop-2-enamide (PubChem CID 91521603) has the molecular formula C22H25F2N3O2 and a molecular weight of 401.46 g/mol. Its IUPAC name is N-[(1R)-1-[3-[2-(aminomethyl)morpholin-4-yl]phenyl]ethyl]-3-(3,5-difluorophenyl)prop-2-enamide.
| Compound Name | N-[(1R)-1-[3-[2-(aminomethyl)morpholin-4-yl]phenyl]ethyl]-3-(3,5-difluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 91521603 |
| Molecular Formula | C22H25F2N3O2 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | N-[(1R)-1-[3-[2-(aminomethyl)morpholin-4-yl]phenyl]ethyl]-3-(3,5-difluorophenyl)prop-2-enamide |
| SMILES | C[C@@H](NC(=O)C=Cc1cc(F)cc(F)c1)c1cccc(N2CCOC(CN)C2)c1 |
| InChI | InChI=1S/C22H25F2N3O2/c1-15(26-22(28)6-5-16-9-18(23)12-19(24)10-16)17-3-2-4-20(11-17)27-7-8-29-21(13-25)14-27/h2-6,9-12,15,21H,7-8,13-14,25H2,1H3,(H,26,28)/t15-,21?/m1/s1 |
| InChIKey | TVCKFWWFGVOSPE-RBFZIWAESA-N |
| XLogP | 3.02 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|