C22H27FN2O3 — CID 142190211
(E)-3-(4-fluorocyclohexa-1,3-dien-1-yl)-N-[(1R)-1-[3-[2-(hydroxymethyl)morpholin-4-yl]phenyl]ethyl]prop-2-enamide (PubChem CID 142190211) has the molecular formula C22H27FN2O3 and a molecular weight of 386.47 g/mol. Its IUPAC name is (E)-3-(4-fluorocyclohexa-1,3-dien-1-yl)-N-[(1R)-1-[3-[2-(hydroxymethyl)morpholin-4-yl]phenyl]ethyl]prop-2-enamide.
| Compound Name | (E)-3-(4-fluorocyclohexa-1,3-dien-1-yl)-N-[(1R)-1-[3-[2-(hydroxymethyl)morpholin-4-yl]phenyl]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 142190211 |
| Molecular Formula | C22H27FN2O3 |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | (E)-3-(4-fluorocyclohexa-1,3-dien-1-yl)-N-[(1R)-1-[3-[2-(hydroxymethyl)morpholin-4-yl]phenyl]ethyl]prop-2-enamide |
| SMILES | C[C@@H](NC(=O)/C=C/C1=CC=C(F)CC1)c1cccc(N2CCOC(CO)C2)c1 |
| InChI | InChI=1S/C22H27FN2O3/c1-16(24-22(27)10-7-17-5-8-19(23)9-6-17)18-3-2-4-20(13-18)25-11-12-28-21(14-25)15-26/h2-5,7-8,10,13,16,21,26H,6,9,11-12,14-15H2,1H3,(H,24,27)/b10-7+/t16-,21?/m1/s1 |
| InChIKey | HSTWWIALXRXASC-RTNZOSJFSA-N |
| XLogP | 3.19 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|