C14H17NO5S — CID 117496210
5-[2-(oxetan-3-ylsulfonyl)phenyl]pyrrolidine-3-carboxylic acid (PubChem CID 117496210) has the molecular formula C14H17NO5S and a molecular weight of 311.36 g/mol. Its IUPAC name is 5-[2-(oxetan-3-ylsulfonyl)phenyl]pyrrolidine-3-carboxylic acid.
| Compound Name | 5-[2-(oxetan-3-ylsulfonyl)phenyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 117496210 |
| Molecular Formula | C14H17NO5S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | 5-[2-(oxetan-3-ylsulfonyl)phenyl]pyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)C1CNC(c2ccccc2S(=O)(=O)C2COC2)C1 |
| InChI | InChI=1S/C14H17NO5S/c16-14(17)9-5-12(15-6-9)11-3-1-2-4-13(11)21(18,19)10-7-20-8-10/h1-4,9-10,12,15H,5-8H2,(H,16,17) |
| InChIKey | VYAOFWRALWDIEI-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |