C15H17ClO5 — CID 117497771
3-(6-chloro-4-formyl-2,3-dimethoxyphenyl)-3-cyclopropylpropanoic acid (PubChem CID 117497771) has the molecular formula C15H17ClO5 and a molecular weight of 312.75 g/mol. Its IUPAC name is 3-(6-chloro-4-formyl-2,3-dimethoxyphenyl)-3-cyclopropylpropanoic acid.
| Compound Name | 3-(6-chloro-4-formyl-2,3-dimethoxyphenyl)-3-cyclopropylpropanoic acid |
|---|---|
| PubChem CID | 117497771 |
| Molecular Formula | C15H17ClO5 |
| Molecular Weight | 312.75 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 3-(6-chloro-4-formyl-2,3-dimethoxyphenyl)-3-cyclopropylpropanoic acid |
| SMILES | COc1c(C=O)cc(Cl)c(C(CC(=O)O)C2CC2)c1OC |
| InChI | InChI=1S/C15H17ClO5/c1-20-14-9(7-17)5-11(16)13(15(14)21-2)10(6-12(18)19)8-3-4-8/h5,7-8,10H,3-4,6H2,1-2H3,(H,18,19) |
| InChIKey | IAOLOXDIHHCEAW-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.75 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|