About 6-[4-(aminomethyl)-1-methylpyrrolidin-2-yl]-2-bromo-3,4-dimethylphenol
6-[4-(aminomethyl)-1-methylpyrrolidin-2-yl]-2-bromo-3,4-dimethylphenol (PubChem CID 117498602) has the molecular formula C14H21BrN2O
and a molecular weight of 313.24 g/mol. Its IUPAC name is 6-[4-(aminomethyl)-1-methylpyrrolidin-2-yl]-2-bromo-3,4-dimethylphenol.
Molecular Properties
| Compound Name | 6-[4-(aminomethyl)-1-methylpyrrolidin-2-yl]-2-bromo-3,4-dimethylphenol |
| PubChem CID | 117498602 |
| Molecular Formula | C14H21BrN2O |
| Molecular Weight | 313.24 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 6-[4-(aminomethyl)-1-methylpyrrolidin-2-yl]-2-bromo-3,4-dimethylphenol |
| SMILES | Cc1cc(C2CC(CN)CN2C)c(O)c(Br)c1C |
| InChI | InChI=1S/C14H21BrN2O/c1-8-4-11(14(18)13(15)9(8)2)12-5-10(6-16)7-17(12)3/h4,10,12,18H,5-7,16H2,1-3H3 |
| InChIKey | KMERMNHIUXZZHO-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.24 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 6-[4-(aminomethyl)-1-methylpyrrolidin-2-yl]-2-bromo-3,4-dimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[4-(aminomethyl)-1-methylpyrrolidin-2-yl]-2-bromo-3,4-dimethylphenol?
The IUPAC name of 6-[4-(aminomethyl)-1-methylpyrrolidin-2-yl]-2-bromo-3,4-dimethylphenol (CID 117498602) is 6-[4-(aminomethyl)-1-methylpyrrolidin-2-yl]-2-bromo-3,4-dimethylphenol.
What is the SMILES notation for 6-[4-(aminomethyl)-1-methylpyrrolidin-2-yl]-2-bromo-3,4-dimethylphenol?
The canonical SMILES for 6-[4-(aminomethyl)-1-methylpyrrolidin-2-yl]-2-bromo-3,4-dimethylphenol is Cc1cc(C2CC(CN)CN2C)c(O)c(Br)c1C.
What is the InChIKey of 6-[4-(aminomethyl)-1-methylpyrrolidin-2-yl]-2-bromo-3,4-dimethylphenol?
The InChIKey is KMERMNHIUXZZHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21BrN2O/c1-8-4-11(14(18)13(15)9(8)2)12-5-10(6-16)7-17(12)3/h4,10,12,18H,5-7,16H2,1-3H3.
What are the key properties of 6-[4-(aminomethyl)-1-methylpyrrolidin-2-yl]-2-bromo-3,4-dimethylphenol?
6-[4-(aminomethyl)-1-methylpyrrolidin-2-yl]-2-bromo-3,4-dimethylphenol has a molecular weight of 313.24 g/mol, XLogP of 2.72, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[4-(aminomethyl)-1-methylpyrrolidin-2-yl]-2-bromo-3,4-dimethylphenol is sourced from PubChem (CID 117498602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).