C12H16F2N2O — CID 117357605
2-[4-(aminomethyl)-1-methylpyrrolidin-2-yl]-4,6-difluorophenol (PubChem CID 117357605) has the molecular formula C12H16F2N2O and a molecular weight of 242.27 g/mol. Its IUPAC name is 2-[4-(aminomethyl)-1-methylpyrrolidin-2-yl]-4,6-difluorophenol.
| Compound Name | 2-[4-(aminomethyl)-1-methylpyrrolidin-2-yl]-4,6-difluorophenol |
|---|---|
| PubChem CID | 117357605 |
| Molecular Formula | C12H16F2N2O |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 2-[4-(aminomethyl)-1-methylpyrrolidin-2-yl]-4,6-difluorophenol |
| SMILES | CN1CC(CN)CC1c1cc(F)cc(F)c1O |
| InChI | InChI=1S/C12H16F2N2O/c1-16-6-7(5-15)2-11(16)9-3-8(13)4-10(14)12(9)17/h3-4,7,11,17H,2,5-6,15H2,1H3 |
| InChIKey | UZIBYNZKCKSGFR-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|