C21H22NO5P — CID 11749915
[(2R)-3-(3-methylphenyl)-2-(naphthalene-2-carbonylamino)propyl] dihydrogen phosphate (PubChem CID 11749915) has the molecular formula C21H22NO5P and a molecular weight of 399.38 g/mol. Its IUPAC name is [(2R)-3-(3-methylphenyl)-2-(naphthalene-2-carbonylamino)propyl] dihydrogen phosphate.
| Compound Name | [(2R)-3-(3-methylphenyl)-2-(naphthalene-2-carbonylamino)propyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 11749915 |
| Molecular Formula | C21H22NO5P |
| Molecular Weight | 399.38 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | [(2R)-3-(3-methylphenyl)-2-(naphthalene-2-carbonylamino)propyl] dihydrogen phosphate |
| SMILES | Cc1cccc(C[C@H](COP(=O)(O)O)NC(=O)c2ccc3ccccc3c2)c1 |
| InChI | InChI=1S/C21H22NO5P/c1-15-5-4-6-16(11-15)12-20(14-27-28(24,25)26)22-21(23)19-10-9-17-7-2-3-8-18(17)13-19/h2-11,13,20H,12,14H2,1H3,(H,22,23)(H2,24,25,26)/t20-/m1/s1 |
| InChIKey | CPOXAOVAIWHBEU-HXUWFJFHSA-N |
| XLogP | 3.60 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.38 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|