C22H19NO3 — CID 45100499
(E,2R)-2-(naphthalene-2-carbonylamino)-5-phenylpent-4-enoic acid (PubChem CID 45100499) has the molecular formula C22H19NO3 and a molecular weight of 345.40 g/mol. Its IUPAC name is (E,2R)-2-(naphthalene-2-carbonylamino)-5-phenylpent-4-enoic acid.
| Compound Name | (E,2R)-2-(naphthalene-2-carbonylamino)-5-phenylpent-4-enoic acid |
|---|---|
| PubChem CID | 45100499 |
| Molecular Formula | C22H19NO3 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | (E,2R)-2-(naphthalene-2-carbonylamino)-5-phenylpent-4-enoic acid |
| SMILES | O=C(N[C@H](C/C=C/c1ccccc1)C(=O)O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C22H19NO3/c24-21(19-14-13-17-10-4-5-11-18(17)15-19)23-20(22(25)26)12-6-9-16-7-2-1-3-8-16/h1-11,13-15,20H,12H2,(H,23,24)(H,25,26)/b9-6+/t20-/m1/s1 |
| InChIKey | OOTIJYFZZMIZHN-AQDCRGGLSA-N |
| XLogP | 4.13 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |