C22H20N6O3 — CID 11750389
5-[(Z)-[5-(carbamoylamino)-2-oxo-1H-indol-3-ylidene]methyl]-N-(2-pyridin-4-ylethyl)-1H-pyrrole-3-carboxamide (PubChem CID 11750389) has the molecular formula C22H20N6O3 and a molecular weight of 416.44 g/mol. Its IUPAC name is 5-[(Z)-[5-(carbamoylamino)-2-oxo-1H-indol-3-ylidene]methyl]-N-(2-pyridin-4-ylethyl)-1H-pyrrole-3-carboxamide.
| Compound Name | 5-[(Z)-[5-(carbamoylamino)-2-oxo-1H-indol-3-ylidene]methyl]-N-(2-pyridin-4-ylethyl)-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 11750389 |
| Molecular Formula | C22H20N6O3 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 5-[(Z)-[5-(carbamoylamino)-2-oxo-1H-indol-3-ylidene]methyl]-N-(2-pyridin-4-ylethyl)-1H-pyrrole-3-carboxamide |
| SMILES | NC(=O)Nc1ccc2c(c1)/C(=C/c1cc(C(=O)NCCc3ccncc3)c[nH]1)C(=O)N2 |
| InChI | InChI=1S/C22H20N6O3/c23-22(31)27-15-1-2-19-17(10-15)18(21(30)28-19)11-16-9-14(12-26-16)20(29)25-8-5-13-3-6-24-7-4-13/h1-4,6-7,9-12,26H,5,8H2,(H,25,29)(H,28,30)(H3,23,27,31)/b18-11- |
| InChIKey | VYUCXCHYYRTQIX-WQRHYEAKSA-N |
| XLogP | 2.37 |
| TPSA | 142.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|