About methyl 2-[[2-(triphenyl-λ5-phosphanylidene)acetyl]amino]benzoate
methyl 2-[[2-(triphenyl-λ5-phosphanylidene)acetyl]amino]benzoate (PubChem CID 11751380) has the molecular formula C28H24NO3P
and a molecular weight of 453.48 g/mol. Its IUPAC name is methyl 2-[[2-(triphenyl-λ5-phosphanylidene)acetyl]amino]benzoate.
Molecular Properties
| Compound Name | methyl 2-[[2-(triphenyl-λ5-phosphanylidene)acetyl]amino]benzoate |
| PubChem CID | 11751380 |
| Molecular Formula | C28H24NO3P |
| Molecular Weight | 453.48 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | methyl 2-[[2-(triphenyl-λ5-phosphanylidene)acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)C=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H24NO3P/c1-32-28(31)25-19-11-12-20-26(25)29-27(30)21-33(22-13-5-2-6-14-22,23-15-7-3-8-16-23)24-17-9-4-10-18-24/h2-21H,1H3,(H,29,30) |
| InChIKey | OHNYJCFPIHWEBU-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 453.48 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[[2-(triphenyl-λ5-phosphanylidene)acetyl]amino]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[[2-(triphenyl-λ5-phosphanylidene)acetyl]amino]benzoate?
The IUPAC name of methyl 2-[[2-(triphenyl-λ5-phosphanylidene)acetyl]amino]benzoate (CID 11751380) is methyl 2-[[2-(triphenyl-λ5-phosphanylidene)acetyl]amino]benzoate.
What is the SMILES notation for methyl 2-[[2-(triphenyl-λ5-phosphanylidene)acetyl]amino]benzoate?
The canonical SMILES for methyl 2-[[2-(triphenyl-λ5-phosphanylidene)acetyl]amino]benzoate is COC(=O)c1ccccc1NC(=O)C=P(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of methyl 2-[[2-(triphenyl-λ5-phosphanylidene)acetyl]amino]benzoate?
The InChIKey is OHNYJCFPIHWEBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H24NO3P/c1-32-28(31)25-19-11-12-20-26(25)29-27(30)21-33(22-13-5-2-6-14-22,23-15-7-3-8-16-23)24-17-9-4-10-18-24/h2-21H,1H3,(H,29,30).
What are the key properties of methyl 2-[[2-(triphenyl-λ5-phosphanylidene)acetyl]amino]benzoate?
methyl 2-[[2-(triphenyl-λ5-phosphanylidene)acetyl]amino]benzoate has a molecular weight of 453.48 g/mol, XLogP of 4.21, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[[2-(triphenyl-λ5-phosphanylidene)acetyl]amino]benzoate is sourced from PubChem (CID 11751380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).