C12H10F3NO3 — CID 142040543
methyl 2-(4,4,4-trifluorobut-2-enoylamino)benzoate (PubChem CID 142040543) has the molecular formula C12H10F3NO3 and a molecular weight of 273.21 g/mol. Its IUPAC name is methyl 2-(4,4,4-trifluorobut-2-enoylamino)benzoate.
| Compound Name | methyl 2-(4,4,4-trifluorobut-2-enoylamino)benzoate |
|---|---|
| PubChem CID | 142040543 |
| Molecular Formula | C12H10F3NO3 |
| Molecular Weight | 273.21 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | methyl 2-(4,4,4-trifluorobut-2-enoylamino)benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)C=CC(F)(F)F |
| InChI | InChI=1S/C12H10F3NO3/c1-19-11(18)8-4-2-3-5-9(8)16-10(17)6-7-12(13,14)15/h2-7H,1H3,(H,16,17) |
| InChIKey | XBMQXWMYQBDSLV-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.21 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|