C20H25Cl2N5O4 — CID 11751757
2-[4-[(3,4-dichloro-5-methyl-1H-pyrrole-2-carbonyl)amino]piperidin-1-yl]-6-(2-methoxyethoxy)pyridine-4-carboxamide (PubChem CID 11751757) has the molecular formula C20H25Cl2N5O4 and a molecular weight of 470.36 g/mol. Its IUPAC name is 2-[4-[(3,4-dichloro-5-methyl-1H-pyrrole-2-carbonyl)amino]piperidin-1-yl]-6-(2-methoxyethoxy)pyridine-4-carboxamide.
| Compound Name | 2-[4-[(3,4-dichloro-5-methyl-1H-pyrrole-2-carbonyl)amino]piperidin-1-yl]-6-(2-methoxyethoxy)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 11751757 |
| Molecular Formula | C20H25Cl2N5O4 |
| Molecular Weight | 470.36 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | 2-[4-[(3,4-dichloro-5-methyl-1H-pyrrole-2-carbonyl)amino]piperidin-1-yl]-6-(2-methoxyethoxy)pyridine-4-carboxamide |
| SMILES | COCCOc1cc(C(N)=O)cc(N2CCC(NC(=O)c3[nH]c(C)c(Cl)c3Cl)CC2)n1 |
| InChI | InChI=1S/C20H25Cl2N5O4/c1-11-16(21)17(22)18(24-11)20(29)25-13-3-5-27(6-4-13)14-9-12(19(23)28)10-15(26-14)31-8-7-30-2/h9-10,13,24H,3-8H2,1-2H3,(H2,23,28)(H,25,29) |
| InChIKey | YLCQQMJUEWWXBC-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 122.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.36 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|