C18H21Cl2N5O3 — CID 86608342
4-[4-[(3,4-dichloro-5-methyl-1H-pyrrole-2-carbonyl)amino]piperidin-1-yl]-N-methoxypyridine-2-carboxamide (PubChem CID 86608342) has the molecular formula C18H21Cl2N5O3 and a molecular weight of 426.30 g/mol. Its IUPAC name is 4-[4-[(3,4-dichloro-5-methyl-1H-pyrrole-2-carbonyl)amino]piperidin-1-yl]-N-methoxypyridine-2-carboxamide.
| Compound Name | 4-[4-[(3,4-dichloro-5-methyl-1H-pyrrole-2-carbonyl)amino]piperidin-1-yl]-N-methoxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 86608342 |
| Molecular Formula | C18H21Cl2N5O3 |
| Molecular Weight | 426.30 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | 4-[4-[(3,4-dichloro-5-methyl-1H-pyrrole-2-carbonyl)amino]piperidin-1-yl]-N-methoxypyridine-2-carboxamide |
| SMILES | CONC(=O)c1cc(N2CCC(NC(=O)c3[nH]c(C)c(Cl)c3Cl)CC2)ccn1 |
| InChI | InChI=1S/C18H21Cl2N5O3/c1-10-14(19)15(20)16(22-10)18(27)23-11-4-7-25(8-5-11)12-3-6-21-13(9-12)17(26)24-28-2/h3,6,9,11,22H,4-5,7-8H2,1-2H3,(H,23,27)(H,24,26) |
| InChIKey | GMHRLZJYPKELEU-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.30 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|