C23H32N4O9S — CID 11753046
methyl (5R,8S)-16-amino-8-[[(2S)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-7,11-dioxo-10-oxa-3-thia-6-azabicyclo[10.4.0]hexadeca-1(12),13,15-triene-5-carboxylate (PubChem CID 11753046) has the molecular formula C23H32N4O9S and a molecular weight of 540.60 g/mol. Its IUPAC name is methyl (5R,8S)-16-amino-8-[[(2S)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-7,11-dioxo-10-oxa-3-thia-6-azabicyclo[10.4.0]hexadeca-1(12),13,15-triene-5-carboxylate.
| Compound Name | methyl (5R,8S)-16-amino-8-[[(2S)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-7,11-dioxo-10-oxa-3-thia-6-azabicyclo[10.4.0]hexadeca-1(12),13,15-triene-5-carboxylate |
|---|---|
| PubChem CID | 11753046 |
| Molecular Formula | C23H32N4O9S |
| Molecular Weight | 540.60 g/mol |
| Exact Mass | 540.19 |
| IUPAC Name | methyl (5R,8S)-16-amino-8-[[(2S)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-7,11-dioxo-10-oxa-3-thia-6-azabicyclo[10.4.0]hexadeca-1(12),13,15-triene-5-carboxylate |
| SMILES | COC(=O)[C@@H]1CSCc2c(N)cccc2C(=O)OC[C@H](NC(=O)[C@H](CO)NC(=O)OC(C)(C)C)C(=O)N1 |
| InChI | InChI=1S/C23H32N4O9S/c1-23(2,3)36-22(33)27-15(8-28)18(29)25-16-9-35-20(31)12-6-5-7-14(24)13(12)10-37-11-17(21(32)34-4)26-19(16)30/h5-7,15-17,28H,8-11,24H2,1-4H3,(H,25,29)(H,26,30)(H,27,33)/t15-,16-,17-/m0/s1 |
| InChIKey | XBMBGOPGOZIYSX-ULQDDVLXSA-N |
| XLogP | -0.30 |
| TPSA | 195.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.60 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|