C26H47N5O9 — CID 90165183
methyl (4S,7S,10S)-10-[[(2S)-2-amino-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]-7-methyl-6,9-dioxo-1,12-dioxa-5,8-diazacyclohexadecane-4-carboxylate (PubChem CID 90165183) has the molecular formula C26H47N5O9 and a molecular weight of 573.69 g/mol. Its IUPAC name is methyl (4S,7S,10S)-10-[[(2S)-2-amino-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]-7-methyl-6,9-dioxo-1,12-dioxa-5,8-diazacyclohexadecane-4-carboxylate.
| Compound Name | methyl (4S,7S,10S)-10-[[(2S)-2-amino-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]-7-methyl-6,9-dioxo-1,12-dioxa-5,8-diazacyclohexadecane-4-carboxylate |
|---|---|
| PubChem CID | 90165183 |
| Molecular Formula | C26H47N5O9 |
| Molecular Weight | 573.69 g/mol |
| Exact Mass | 573.34 |
| IUPAC Name | methyl (4S,7S,10S)-10-[[(2S)-2-amino-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]-7-methyl-6,9-dioxo-1,12-dioxa-5,8-diazacyclohexadecane-4-carboxylate |
| SMILES | COC(=O)[C@@H]1CCOCCCCOC[C@H](NC(=O)[C@@H](N)CCCCNC(=O)OC(C)(C)C)C(=O)N[C@@H](C)C(=O)N1 |
| InChI | InChI=1S/C26H47N5O9/c1-17-21(32)30-19(24(35)37-5)11-15-38-13-8-9-14-39-16-20(23(34)29-17)31-22(33)18(27)10-6-7-12-28-25(36)40-26(2,3)4/h17-20H,6-16,27H2,1-5H3,(H,28,36)(H,29,34)(H,30,32)(H,31,33)/t17-,18-,19-,20-/m0/s1 |
| InChIKey | BACUJYDSUFYBPP-MUGJNUQGSA-N |
| XLogP | -0.13 |
| TPSA | 196.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.69 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|