C18H32N2O6S — CID 54545330
[2-(oxan-2-ylsulfanyl)acetyl] (2S)-2-amino-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate (PubChem CID 54545330) has the molecular formula C18H32N2O6S and a molecular weight of 404.53 g/mol. Its IUPAC name is [2-(oxan-2-ylsulfanyl)acetyl] (2S)-2-amino-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate.
| Compound Name | [2-(oxan-2-ylsulfanyl)acetyl] (2S)-2-amino-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
|---|---|
| PubChem CID | 54545330 |
| Molecular Formula | C18H32N2O6S |
| Molecular Weight | 404.53 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | [2-(oxan-2-ylsulfanyl)acetyl] (2S)-2-amino-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
| SMILES | CC(C)(C)OC(=O)NCCCC[C@H](N)C(=O)OC(=O)CSC1CCCCO1 |
| InChI | InChI=1S/C18H32N2O6S/c1-18(2,3)26-17(23)20-10-6-4-8-13(19)16(22)25-14(21)12-27-15-9-5-7-11-24-15/h13,15H,4-12,19H2,1-3H3,(H,20,23)/t13-,15?/m0/s1 |
| InChIKey | ZGDDHKSKEKNNGZ-CFMCSPIPSA-N |
| XLogP | 2.34 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.53 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|