C26H20N4O5 — CID 11754377
6-acetyl-N-[(4-methylphenyl)carbamoyl]-2-(4-nitrophenyl)quinoline-4-carboxamide (PubChem CID 11754377) has the molecular formula C26H20N4O5 and a molecular weight of 468.47 g/mol. Its IUPAC name is 6-acetyl-N-[(4-methylphenyl)carbamoyl]-2-(4-nitrophenyl)quinoline-4-carboxamide.
| Compound Name | 6-acetyl-N-[(4-methylphenyl)carbamoyl]-2-(4-nitrophenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 11754377 |
| Molecular Formula | C26H20N4O5 |
| Molecular Weight | 468.47 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | 6-acetyl-N-[(4-methylphenyl)carbamoyl]-2-(4-nitrophenyl)quinoline-4-carboxamide |
| SMILES | CC(=O)c1ccc2nc(-c3ccc([N+](=O)[O-])cc3)cc(C(=O)NC(=O)Nc3ccc(C)cc3)c2c1 |
| InChI | InChI=1S/C26H20N4O5/c1-15-3-8-19(9-4-15)27-26(33)29-25(32)22-14-24(17-5-10-20(11-6-17)30(34)35)28-23-12-7-18(16(2)31)13-21(22)23/h3-14H,1-2H3,(H2,27,29,32,33) |
| InChIKey | ALVRUILDLATEQK-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 131.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.47 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|