C26H21N3O5 — CID 135525412
6-acetyl-2-(2-hydroxyphenyl)-N-[(4-methoxyphenyl)carbamoyl]quinoline-4-carboxamide (PubChem CID 135525412) has the molecular formula C26H21N3O5 and a molecular weight of 455.47 g/mol. Its IUPAC name is 6-acetyl-2-(2-hydroxyphenyl)-N-[(4-methoxyphenyl)carbamoyl]quinoline-4-carboxamide.
| Compound Name | 6-acetyl-2-(2-hydroxyphenyl)-N-[(4-methoxyphenyl)carbamoyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 135525412 |
| Molecular Formula | C26H21N3O5 |
| Molecular Weight | 455.47 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | 6-acetyl-2-(2-hydroxyphenyl)-N-[(4-methoxyphenyl)carbamoyl]quinoline-4-carboxamide |
| SMILES | COc1ccc(NC(=O)NC(=O)c2cc(-c3ccccc3O)nc3ccc(C(C)=O)cc23)cc1 |
| InChI | InChI=1S/C26H21N3O5/c1-15(30)16-7-12-22-20(13-16)21(14-23(28-22)19-5-3-4-6-24(19)31)25(32)29-26(33)27-17-8-10-18(34-2)11-9-17/h3-14,31H,1-2H3,(H2,27,29,32,33) |
| InChIKey | IBBPECVDBUNAQV-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 117.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.47 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |