C27H21FN4O2 — CID 50779234
2-[1-(4-fluorophenyl)-5-methylpyrazol-4-yl]-N-(4-methoxyphenyl)quinoline-4-carboxamide (PubChem CID 50779234) has the molecular formula C27H21FN4O2 and a molecular weight of 452.49 g/mol. Its IUPAC name is 2-[1-(4-fluorophenyl)-5-methylpyrazol-4-yl]-N-(4-methoxyphenyl)quinoline-4-carboxamide.
| Compound Name | 2-[1-(4-fluorophenyl)-5-methylpyrazol-4-yl]-N-(4-methoxyphenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 50779234 |
| Molecular Formula | C27H21FN4O2 |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | 2-[1-(4-fluorophenyl)-5-methylpyrazol-4-yl]-N-(4-methoxyphenyl)quinoline-4-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cc(-c3cnn(-c4ccc(F)cc4)c3C)nc3ccccc23)cc1 |
| InChI | InChI=1S/C27H21FN4O2/c1-17-24(16-29-32(17)20-11-7-18(28)8-12-20)26-15-23(22-5-3-4-6-25(22)31-26)27(33)30-19-9-13-21(34-2)14-10-19/h3-16H,1-2H3,(H,30,33) |
| InChIKey | ICTLVIURSPWJOY-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |