C31H30N4O — CID 46323368
2-[1-(4-ethylphenyl)-5-methylpyrazol-4-yl]-N-(4-propan-2-ylphenyl)quinoline-4-carboxamide (PubChem CID 46323368) has the molecular formula C31H30N4O and a molecular weight of 474.61 g/mol. Its IUPAC name is 2-[1-(4-ethylphenyl)-5-methylpyrazol-4-yl]-N-(4-propan-2-ylphenyl)quinoline-4-carboxamide.
| Compound Name | 2-[1-(4-ethylphenyl)-5-methylpyrazol-4-yl]-N-(4-propan-2-ylphenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 46323368 |
| Molecular Formula | C31H30N4O |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.24 |
| IUPAC Name | 2-[1-(4-ethylphenyl)-5-methylpyrazol-4-yl]-N-(4-propan-2-ylphenyl)quinoline-4-carboxamide |
| SMILES | CCc1ccc(-n2ncc(-c3cc(C(=O)Nc4ccc(C(C)C)cc4)c4ccccc4n3)c2C)cc1 |
| InChI | InChI=1S/C31H30N4O/c1-5-22-10-16-25(17-11-22)35-21(4)28(19-32-35)30-18-27(26-8-6-7-9-29(26)34-30)31(36)33-24-14-12-23(13-15-24)20(2)3/h6-20H,5H2,1-4H3,(H,33,36) |
| InChIKey | MWMDYCZUGFEPEM-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |