C30H28N4O — CID 92869383
2-[1-(4-ethylphenyl)-5-methylpyrazol-4-yl]-N-[(1R)-1-phenylethyl]quinoline-4-carboxamide (PubChem CID 92869383) has the molecular formula C30H28N4O and a molecular weight of 460.58 g/mol. Its IUPAC name is 2-[1-(4-ethylphenyl)-5-methylpyrazol-4-yl]-N-[(1R)-1-phenylethyl]quinoline-4-carboxamide.
| Compound Name | 2-[1-(4-ethylphenyl)-5-methylpyrazol-4-yl]-N-[(1R)-1-phenylethyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 92869383 |
| Molecular Formula | C30H28N4O |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.23 |
| IUPAC Name | 2-[1-(4-ethylphenyl)-5-methylpyrazol-4-yl]-N-[(1R)-1-phenylethyl]quinoline-4-carboxamide |
| SMILES | CCc1ccc(-n2ncc(-c3cc(C(=O)N[C@H](C)c4ccccc4)c4ccccc4n3)c2C)cc1 |
| InChI | InChI=1S/C30H28N4O/c1-4-22-14-16-24(17-15-22)34-21(3)27(19-31-34)29-18-26(25-12-8-9-13-28(25)33-29)30(35)32-20(2)23-10-6-5-7-11-23/h5-20H,4H2,1-3H3,(H,32,35)/t20-/m1/s1 |
| InChIKey | CSXPPCZRNGQYEV-HXUWFJFHSA-N |
| XLogP | 6.45 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |