C26H18F2N4O — CID 46323415
N-(3-fluorophenyl)-2-[1-(4-fluorophenyl)-5-methylpyrazol-4-yl]quinoline-4-carboxamide (PubChem CID 46323415) has the molecular formula C26H18F2N4O and a molecular weight of 440.45 g/mol. Its IUPAC name is N-(3-fluorophenyl)-2-[1-(4-fluorophenyl)-5-methylpyrazol-4-yl]quinoline-4-carboxamide.
| Compound Name | N-(3-fluorophenyl)-2-[1-(4-fluorophenyl)-5-methylpyrazol-4-yl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 46323415 |
| Molecular Formula | C26H18F2N4O |
| Molecular Weight | 440.45 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | N-(3-fluorophenyl)-2-[1-(4-fluorophenyl)-5-methylpyrazol-4-yl]quinoline-4-carboxamide |
| SMILES | Cc1c(-c2cc(C(=O)Nc3cccc(F)c3)c3ccccc3n2)cnn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C26H18F2N4O/c1-16-23(15-29-32(16)20-11-9-17(27)10-12-20)25-14-22(21-7-2-3-8-24(21)31-25)26(33)30-19-6-4-5-18(28)13-19/h2-15H,1H3,(H,30,33) |
| InChIKey | XAYCAHKRNORUNS-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.45 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |